Products 1189944-95-3
CAS 1189944-95-3 appears in our catalog under these names: Metaxalone-d6, >95% (HPLC), Metaxalone-d6, Metaxalone–d6. Offered by: TRC, Chemat Brand, GLPBio, TargetMol, MedChemExpress. Available pack sizes: 10mg, 2,5mg, 25mg, on request, 1mg, 1 mg.
5-[[3,5-bis(trideuteriomethyl)phenoxy]methyl]-1,3-oxazolidin-2-one (CAS 1189944-95-3) is a chemical compound with the molecular formula C12H15NO3 and a molecular weight of 227.29 g/mol. IUPAC name: 5-[[3,5-bis(trideuteriomethyl)phenoxy]methyl]-1,3-oxazolidin-2-one. InChIKey: IMWZZHHPURKASS-WFGJKAKNSA-N.
| Molecular formula | C12H15NO3 |
|---|---|
| Molecular weight | 227.29 g/mol |
| IUPAC name | 5-[[3,5-bis(trideuteriomethyl)phenoxy]methyl]-1,3-oxazolidin-2-one |
| InChIKey | IMWZZHHPURKASS-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC(=CC(=C1)OCC2CNC(=O)O2)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)