Products 69517-61-9
CAS 69517-61-9 is the registry number for 4-[(3,4-Dimethylphenyl)amino]-4-oxobutanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-(3,4-dimethylanilino)-4-oxobutanoic acid (CAS 69517-61-9) is a chemical compound with the molecular formula C12H15NO3 and a molecular weight of 221.25 g/mol. IUPAC name: 4-(3,4-dimethylanilino)-4-oxobutanoic acid. InChIKey: IOPDCIWZBHGMOA-UHFFFAOYSA-N.
| Molecular formula | C12H15NO3 |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | 4-(3,4-dimethylanilino)-4-oxobutanoic acid |
| InChIKey | IOPDCIWZBHGMOA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)CCC(=O)O)C |
Computed by PubChem (NCBI)
Synonyms:
Succinamic acid, N-(3,4-dimethylphenyl)-, N-(3,4-Xylyl)succinamic acid, N-3,4-Dimethylphenylsuccinamic acid, 4-[(3,4-dimethylphenyl)amino]-4-oxobutanoic acid, 4-(3,4-Dimethylanilino)-4-oxobutanoic acid, butanoic acid, 4-[(3,4-dimethylphenyl)amino]-4-oxo-, 3-[(3,4-dimethylphenyl)carbamoyl]propanoic acid, 4-((3,4-Dimethylphenyl)amino)-4-oxobutanoic acid, 3-[N-(3,4-dimethylphenyl)carbamoyl]propanoic acid, Oprea1_000096