CAS 1189957-44-5 appears in our catalog under these names: N-(1-(3’-Benzyloxyphenyl)ethyl)-N-(methyl-d3)amine, 1-(3-(Benzyloxy)phenyl)-N-methylethan-1-amine-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 100 mg, 10 mg.
1-(3-phenylmethoxyphenyl)-N-(trideuteriomethyl)ethanamine (CAS 1189957-44-5) is a chemical compound with the molecular formula C16H19NO and a molecular weight of 244.35 g/mol. IUPAC name: 1-(3-phenylmethoxyphenyl)-N-(trideuteriomethyl)ethanamine. InChIKey: GKEMNSXFQMKPAE-BMSJAHLVSA-N.
| Molecular formula | C16H19NO |
|---|---|
| Molecular weight | 244.35 g/mol |
| IUPAC name | 1-(3-phenylmethoxyphenyl)-N-(trideuteriomethyl)ethanamine |
| InChIKey | GKEMNSXFQMKPAE-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])NC(C)C1=CC(=CC=C1)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)