CAS 1189958-49-3 appears in our catalog under these names: 4-(2-Aminoethoxy)-3-methoxyphenol-d3, 4–(2–Aminoethoxy)–3–methoxyphenol–d3. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 50mg, 10 mg, 1 mg.
4-(2-aminoethoxy)-3-(trideuteriomethoxy)phenol (CAS 1189958-49-3) is a chemical compound with the molecular formula C9H13NO3 and a molecular weight of 186.22 g/mol. IUPAC name: 4-(2-aminoethoxy)-3-(trideuteriomethoxy)phenol. InChIKey: ZJWDKSXPRPBBIJ-FIBGUPNXSA-N.
| Molecular formula | C9H13NO3 |
|---|---|
| Molecular weight | 186.22 g/mol |
| IUPAC name | 4-(2-aminoethoxy)-3-(trideuteriomethoxy)phenol |
| InChIKey | ZJWDKSXPRPBBIJ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=CC(=C1)O)OCCN |
Computed by PubChem (NCBI)