CAS 1189967-22-3 is the registry number for N-Methyl 3,3-Diphenylpropionamide-d3. Offered by: TRC. Available pack sizes: 250mg, 25mg.
3,3-diphenyl-N-(trideuteriomethyl)propanamide (CAS 1189967-22-3) is a chemical compound with the molecular formula C16H17NO and a molecular weight of 242.33 g/mol. IUPAC name: 3,3-diphenyl-N-(trideuteriomethyl)propanamide. InChIKey: DBUBYNLFHWVMRH-FIBGUPNXSA-N.
| Molecular formula | C16H17NO |
|---|---|
| Molecular weight | 242.33 g/mol |
| IUPAC name | 3,3-diphenyl-N-(trideuteriomethyl)propanamide |
| InChIKey | DBUBYNLFHWVMRH-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])NC(=O)CC(C1=CC=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)