Products 1951425-11-8
CAS 1951425-11-8 is the registry number for (R)-2-(Benzylideneamino)-3-phenylpropan-1-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
(2R)-2-(benzylideneamino)-3-phenylpropan-1-ol (CAS 1951425-11-8) is a chemical compound with the molecular formula C16H17NO and a molecular weight of 239.31 g/mol. IUPAC name: (2R)-2-(benzylideneamino)-3-phenylpropan-1-ol. InChIKey: XPAUYOLNAAYWDN-MRXNPFEDSA-N.
| Molecular formula | C16H17NO |
|---|---|
| Molecular weight | 239.31 g/mol |
| IUPAC name | (2R)-2-(benzylideneamino)-3-phenylpropan-1-ol |
| InChIKey | XPAUYOLNAAYWDN-MRXNPFEDSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H](CO)N=CC2=CC=CC=C2 |
Computed by PubChem (NCBI)