Products 1189971-04-7
CAS 1189971-04-7 appears in our catalog under these names: N-Desmethyl Clomipramine-d3 HCl, N-Desmethyl Clomipramine-d3 Hydrochloride, >95% (HPLC), N-Desmethyl Clomipramine-d3, N–Desmethyl Clomipramine D3 hydrochloride (Desmethylclomipramine D3 hydrochloride), N-Desmethyl clomipramine-d3 (hydrochloride), 99.81%. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 5mg, 500ug, 5 mg, 1 mg, 10 mg.
3-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-(trideuteriomethyl)propan-1-amine;hydrochloride (CAS 1189971-04-7) is a chemical compound with the molecular formula C18H22Cl2N2 and a molecular weight of 340.3 g/mol. IUPAC name: 3-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-(trideuteriomethyl)propan-1-amine;hydrochloride. InChIKey: KMDDAZOLOSKTKZ-NIIDSAIPSA-N.
| Molecular formula | C18H22Cl2N2 |
|---|---|
| Molecular weight | 340.3 g/mol |
| IUPAC name | 3-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-(trideuteriomethyl)propan-1-amine;hydrochloride |
| InChIKey | KMDDAZOLOSKTKZ-NIIDSAIPSA-N |
| SMILES | [2H]C([2H])([2H])NCCCN1C2=CC=CC=C2CCC3=C1C=C(C=C3)Cl.Cl |
Computed by PubChem (NCBI)