CAS 1246816-11-4 is the registry number for Chlor Cyclizine-d4 Hydrochloride. Offered by: TRC. Available pack sizes: 25mg.
1-[(4-chlorophenyl)-phenylmethyl]-2,2,6,6-tetradeuterio-4-methylpiperazine;hydrochloride (CAS 1246816-11-4) is a chemical compound with the molecular formula C18H22Cl2N2 and a molecular weight of 341.3 g/mol. IUPAC name: 1-[(4-chlorophenyl)-phenylmethyl]-2,2,6,6-tetradeuterio-4-methylpiperazine;hydrochloride. InChIKey: MSIJLVMSKDXAQN-MMJSDMDPSA-N.
| Molecular formula | C18H22Cl2N2 |
|---|---|
| Molecular weight | 341.3 g/mol |
| IUPAC name | 1-[(4-chlorophenyl)-phenylmethyl]-2,2,6,6-tetradeuterio-4-methylpiperazine;hydrochloride |
| InChIKey | MSIJLVMSKDXAQN-MMJSDMDPSA-N |
| SMILES | [2H]C1(CN(CC(N1C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl)([2H])[2H])C)[2H].Cl |
Computed by PubChem (NCBI)