CAS 1189973-29-2 is the registry number for (1–(5–Bromopyrimidin–2–yl)piperidin–3–yl)methanol. Offered by: GLPBio. Available pack sizes: 1g, 250mg, 5g.
[1-(5-bromopyrimidin-2-yl)piperidin-3-yl]methanol (CAS 1189973-29-2) is a chemical compound with the molecular formula C10H14BrN3O and a molecular weight of 272.14 g/mol. IUPAC name: [1-(5-bromopyrimidin-2-yl)piperidin-3-yl]methanol. InChIKey: OXGIOCSHKYSFOC-UHFFFAOYSA-N.
| Molecular formula | C10H14BrN3O |
|---|---|
| Molecular weight | 272.14 g/mol |
| IUPAC name | [1-(5-bromopyrimidin-2-yl)piperidin-3-yl]methanol |
| InChIKey | OXGIOCSHKYSFOC-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C2=NC=C(C=N2)Br)CO |
Computed by PubChem (NCBI)