CAS 1715030-01-5 is the registry number for Rel-3-bromo-5-((1R,3R)-3-methoxycyclopentyl)pyrazin-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-5-[(1R,3R)-3-methoxycyclopentyl]pyrazin-2-amine (CAS 1715030-01-5) is a chemical compound with the molecular formula C10H14BrN3O and a molecular weight of 272.14 g/mol. IUPAC name: 3-bromo-5-[(1R,3R)-3-methoxycyclopentyl]pyrazin-2-amine. InChIKey: ZONCXUCJKOIMAT-RNFRBKRXSA-N.
| Molecular formula | C10H14BrN3O |
|---|---|
| Molecular weight | 272.14 g/mol |
| IUPAC name | 3-bromo-5-[(1R,3R)-3-methoxycyclopentyl]pyrazin-2-amine |
| InChIKey | ZONCXUCJKOIMAT-RNFRBKRXSA-N |
| SMILES | CO[C@@H]1CC[C@H](C1)C2=CN=C(C(=N2)Br)N |
Computed by PubChem (NCBI)