Products 1189980-40-2
CAS 1189980-40-2 appears in our catalog under these names: rac N-Desmethyl Venlafaxine-d3, >95% (HPLC), N–Desmethyl venlafaxine–d3, N-Desmethyl venlafaxine-d3. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 2500μg, 2.5 mg.
1-[1-(4-methoxyphenyl)-2-(trideuteriomethylamino)ethyl]cyclohexan-1-ol (CAS 1189980-40-2) is a chemical compound with the molecular formula C16H25NO2 and a molecular weight of 266.39 g/mol. IUPAC name: 1-[1-(4-methoxyphenyl)-2-(trideuteriomethylamino)ethyl]cyclohexan-1-ol. InChIKey: MKAFOJAJJMUXLW-FIBGUPNXSA-N.
| Molecular formula | C16H25NO2 |
|---|---|
| Molecular weight | 266.39 g/mol |
| IUPAC name | 1-[1-(4-methoxyphenyl)-2-(trideuteriomethylamino)ethyl]cyclohexan-1-ol |
| InChIKey | MKAFOJAJJMUXLW-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])NCC(C1=CC=C(C=C1)OC)C2(CCCCC2)O |
Computed by PubChem (NCBI)