CAS 14446-64-1 is the registry number for 2,6-Di-tert-butyl-4-[(1e)-(methoxyimino)methyl]phenol, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
2,6-ditert-butyl-4-[(E)-methoxyiminomethyl]phenol (CAS 14446-64-1) is a chemical compound with the molecular formula C16H25NO2 and a molecular weight of 263.37 g/mol. IUPAC name: 2,6-ditert-butyl-4-[(E)-methoxyiminomethyl]phenol. InChIKey: MVKGDHBJUOEZQS-LICLKQGHSA-N.
| Molecular formula | C16H25NO2 |
|---|---|
| Molecular weight | 263.37 g/mol |
| IUPAC name | 2,6-ditert-butyl-4-[(E)-methoxyiminomethyl]phenol |
| InChIKey | MVKGDHBJUOEZQS-LICLKQGHSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)/C=N/OC |
Computed by PubChem (NCBI)