CAS 1189986-59-1 appears in our catalog under these names: Haloperidol-D4, Haloperidol-d4, >95% (HPLC), Haloperidol-d4 (4-chlorophenyl-d4), 99 atom % D, min 98% Chemical Purity, Haloperidol-D4 0.1 mg/ml in Methanol, Haloperidol D4. Offered by: Chemat Brand, TRC, CDN, LoGiCal, TargetMol. Available pack sizes: on request, 10mg, 2,5mg, 5mg, 0,01g, 0,005g, 1ml, 1mg.
4-[4-(4-chloro-2,3,5,6-tetradeuteriophenyl)-4-hydroxypiperidin-1-yl]-1-(4-fluorophenyl)butan-1-one (CAS 1189986-59-1) is a chemical compound with the molecular formula C21H23ClFNO2 and a molecular weight of 379.9 g/mol. IUPAC name: 4-[4-(4-chloro-2,3,5,6-tetradeuteriophenyl)-4-hydroxypiperidin-1-yl]-1-(4-fluorophenyl)butan-1-one. InChIKey: LNEPOXFFQSENCJ-KDWZCNHSSA-N.
| Molecular formula | C21H23ClFNO2 |
|---|---|
| Molecular weight | 379.9 g/mol |
| IUPAC name | 4-[4-(4-chloro-2,3,5,6-tetradeuteriophenyl)-4-hydroxypiperidin-1-yl]-1-(4-fluorophenyl)butan-1-one |
| InChIKey | LNEPOXFFQSENCJ-KDWZCNHSSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C2(CCN(CC2)CCCC(=O)C3=CC=C(C=C3)F)O)[2H])[2H])Cl)[2H] |
Computed by PubChem (NCBI)