CAS 1704801-24-0 appears in our catalog under these names: Ax-024 hydrochloride, 95%, AX-024 hydrochloride/ 99.9%, AX–024 hydrochloride, AX-024 HCl, AX-024 HCl 98%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 1g, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg.
1-[[4-(4-fluorophenyl)-6-methoxy-2H-chromen-3-yl]methyl]pyrrolidine;hydrochloride (CAS 1704801-24-0) is a chemical compound with the molecular formula C21H23ClFNO2 and a molecular weight of 375.9 g/mol. IUPAC name: 1-[[4-(4-fluorophenyl)-6-methoxy-2H-chromen-3-yl]methyl]pyrrolidine;hydrochloride. InChIKey: DGBCIMPGYRVTPD-UHFFFAOYSA-N.
| Molecular formula | C21H23ClFNO2 |
|---|---|
| Molecular weight | 375.9 g/mol |
| IUPAC name | 1-[[4-(4-fluorophenyl)-6-methoxy-2H-chromen-3-yl]methyl]pyrrolidine;hydrochloride |
| InChIKey | DGBCIMPGYRVTPD-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)OCC(=C2C3=CC=C(C=C3)F)CN4CCCC4.Cl |
Computed by PubChem (NCBI)