CAS 1189989-60-3 is the registry number for 2-Methyl-3-(trifluoromethyl)aniline-d3. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(trideuteriomethyl)-3-(trifluoromethyl)aniline (CAS 1189989-60-3) is a chemical compound with the molecular formula C8H8F3N and a molecular weight of 178.17 g/mol. IUPAC name: 2-(trideuteriomethyl)-3-(trifluoromethyl)aniline. InChIKey: TWLDBACVSHADLI-FIBGUPNXSA-N.
| Molecular formula | C8H8F3N |
|---|---|
| Molecular weight | 178.17 g/mol |
| IUPAC name | 2-(trideuteriomethyl)-3-(trifluoromethyl)aniline |
| InChIKey | TWLDBACVSHADLI-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(C=CC=C1N)C(F)(F)F |
Computed by PubChem (NCBI)