Products 1190003-26-9
CAS 1190003-26-9 appears in our catalog under these names: Citalopram-d6, Citalopram-d6, >95% (HPLC), Citalopram-d6, 98.90%. Offered by: Hubei YoungXin, TRC, TargetMol, Biosynth, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg, 1 mg.
1-[3-[bis(trideuteriomethyl)amino]propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile (CAS 1190003-26-9) is a chemical compound with the molecular formula C20H21FN2O and a molecular weight of 330.4 g/mol. IUPAC name: 1-[3-[bis(trideuteriomethyl)amino]propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile. InChIKey: WSEQXVZVJXJVFP-WFGJKAKNSA-N.
| Molecular formula | C20H21FN2O |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | 1-[3-[bis(trideuteriomethyl)amino]propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile |
| InChIKey | WSEQXVZVJXJVFP-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])N(CCCC1(C2=C(CO1)C=C(C=C2)C#N)C3=CC=C(C=C3)F)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)