CAS 1370643-23-4 is the registry number for Citalopram Impurity 25. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(E)-4-(dimethylamino)-1-(4-fluorophenyl)but-1-enyl]-3-(hydroxymethyl)benzonitrile (CAS 1370643-23-4) is a chemical compound with the molecular formula C20H21FN2O and a molecular weight of 324.4 g/mol. IUPAC name: 4-[(E)-4-(dimethylamino)-1-(4-fluorophenyl)but-1-enyl]-3-(hydroxymethyl)benzonitrile. InChIKey: IAICSOQOSARWDY-RMOCHZDMSA-N.
| Molecular formula | C20H21FN2O |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | 4-[(E)-4-(dimethylamino)-1-(4-fluorophenyl)but-1-enyl]-3-(hydroxymethyl)benzonitrile |
| InChIKey | IAICSOQOSARWDY-RMOCHZDMSA-N |
| SMILES | CN(C)CC/C=C(\C1=CC=C(C=C1)F)/C2=C(C=C(C=C2)C#N)CO |
Computed by PubChem (NCBI)