CAS 119003-37-1 is the registry number for 3-Amino-4,5,6-trimethylthieno[2,3-b]pyridine-2-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-amino-4,5,6-trimethylthieno[2,3-b]pyridine-2-carboxamide (CAS 119003-37-1) is a chemical compound with the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. IUPAC name: 3-amino-4,5,6-trimethylthieno[2,3-b]pyridine-2-carboxamide. InChIKey: WSQCQUQIQLFVKF-UHFFFAOYSA-N.
| Molecular formula | C11H13N3OS |
|---|---|
| Molecular weight | 235.31 g/mol |
| IUPAC name | 3-amino-4,5,6-trimethylthieno[2,3-b]pyridine-2-carboxamide |
| InChIKey | WSQCQUQIQLFVKF-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N=C1C)SC(=C2N)C(=O)N)C |
Computed by PubChem (NCBI)