CAS 123217-00-5 is the registry number for 5-[(2,3-Dimethylphenoxy)methyl]-1,3,4-thiadiazol-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-[(2,3-dimethylphenoxy)methyl]-1,3,4-thiadiazol-2-amine (CAS 123217-00-5) is a chemical compound with the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. IUPAC name: 5-[(2,3-dimethylphenoxy)methyl]-1,3,4-thiadiazol-2-amine. InChIKey: QGXXUPNUTLOJFQ-UHFFFAOYSA-N.
| Molecular formula | C11H13N3OS |
|---|---|
| Molecular weight | 235.31 g/mol |
| IUPAC name | 5-[(2,3-dimethylphenoxy)methyl]-1,3,4-thiadiazol-2-amine |
| InChIKey | QGXXUPNUTLOJFQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)OCC2=NN=C(S2)N)C |
Computed by PubChem (NCBI)