CAS 1190198-25-4 appears in our catalog under these names: Methyl 5-bromo-4,6-dihydroxynicotinate, 95%, Methyl 5-bromo-4,6-dihydroxynicotinate, 95+%, Methyl 5-bromo-4,6-dihydroxypyridine-3-carboxylate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 100mg, 5g, 10g, 250mg, 1g, 0,5g.
Methyl 5-bromo-4-hydroxy-6-oxo-1H-pyridine-3-carboxylate (CAS 1190198-25-4) is a chemical compound with the molecular formula C7H6BrNO4 and a molecular weight of 248.03 g/mol. IUPAC name: methyl 5-bromo-4-hydroxy-6-oxo-1H-pyridine-3-carboxylate. InChIKey: MXEWVVROXOCIKD-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO4 |
|---|---|
| Molecular weight | 248.03 g/mol |
| IUPAC name | methyl 5-bromo-4-hydroxy-6-oxo-1H-pyridine-3-carboxylate |
| InChIKey | MXEWVVROXOCIKD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CNC(=O)C(=C1O)Br |
Computed by PubChem (NCBI)