CAS 1864051-70-6 is the registry number for 6-Bromo-3-methoxy-2-nitrophenol, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
6-bromo-3-methoxy-2-nitrophenol (CAS 1864051-70-6) is a chemical compound with the molecular formula C7H6BrNO4 and a molecular weight of 248.03 g/mol. IUPAC name: 6-bromo-3-methoxy-2-nitrophenol. InChIKey: VKMUUEFMOLCQPZ-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO4 |
|---|---|
| Molecular weight | 248.03 g/mol |
| IUPAC name | 6-bromo-3-methoxy-2-nitrophenol |
| InChIKey | VKMUUEFMOLCQPZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)Br)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)