CAS 1190235-58-5 is the registry number for 2-[3-(Trifluoromethyl)phenyl]-4-thiazolemethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
[2-[3-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methanol (CAS 1190235-58-5) is a chemical compound with the molecular formula C11H8F3NOS and a molecular weight of 259.25 g/mol. IUPAC name: [2-[3-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methanol. InChIKey: GKUFOBFBERSFCZ-UHFFFAOYSA-N.
| Molecular formula | C11H8F3NOS |
|---|---|
| Molecular weight | 259.25 g/mol |
| IUPAC name | [2-[3-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methanol |
| InChIKey | GKUFOBFBERSFCZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C2=NC(=CS2)CO |
Computed by PubChem (NCBI)