CAS 857284-25-4 is the registry number for {2-[4-(Trifluoromethyl)phenyl]-1,3-thiazol-4-yl}methanol, 97% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g.
[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methanol (CAS 857284-25-4) is a chemical compound with the molecular formula C11H8F3NOS and a molecular weight of 259.25 g/mol. IUPAC name: [2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methanol. InChIKey: LXSRKDWWLYYTMN-UHFFFAOYSA-N.
| Molecular formula | C11H8F3NOS |
|---|---|
| Molecular weight | 259.25 g/mol |
| IUPAC name | [2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methanol |
| InChIKey | LXSRKDWWLYYTMN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=CS2)CO)C(F)(F)F |
Computed by PubChem (NCBI)