CAS 1190315-74-2 appears in our catalog under these names: 4-Chloro-5-fluoro-7-aza-2-oxindole, 95%, 4-Chloro-5-fluoro-1H-pyrrolo(2,3-b)pyridin-2(3H)-one, 97%, 4-Chloro-5-fluoro-1H-pyrrolo[2,3-b]pyridin-2(3H)-one, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 100mg, 500mg.
4-chloro-5-fluoro-1,3-dihydropyrrolo[2,3-b]pyridin-2-one (CAS 1190315-74-2) is a chemical compound with the molecular formula C7H4ClFN2O and a molecular weight of 186.57 g/mol. IUPAC name: 4-chloro-5-fluoro-1,3-dihydropyrrolo[2,3-b]pyridin-2-one. InChIKey: AFHGYJFHZMMUJA-UHFFFAOYSA-N.
| Molecular formula | C7H4ClFN2O |
|---|---|
| Molecular weight | 186.57 g/mol |
| IUPAC name | 4-chloro-5-fluoro-1,3-dihydropyrrolo[2,3-b]pyridin-2-one |
| InChIKey | AFHGYJFHZMMUJA-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CN=C2NC1=O)F)Cl |
Computed by PubChem (NCBI)