CAS 1268032-07-0 appears in our catalog under these names: 6-Chloro-5-fluoro-1,3-benzoxazol-2-amine, 98%, 6-Chloro-5-fluorobenzo(d)oxazol-2-amine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
6-chloro-5-fluoro-1,3-benzoxazol-2-amine (CAS 1268032-07-0) is a chemical compound with the molecular formula C7H4ClFN2O and a molecular weight of 186.57 g/mol. IUPAC name: 6-chloro-5-fluoro-1,3-benzoxazol-2-amine. InChIKey: RTHDLWJUOJEKRM-UHFFFAOYSA-N.
| Molecular formula | C7H4ClFN2O |
|---|---|
| Molecular weight | 186.57 g/mol |
| IUPAC name | 6-chloro-5-fluoro-1,3-benzoxazol-2-amine |
| InChIKey | RTHDLWJUOJEKRM-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1F)Cl)OC(=N2)N |
Computed by PubChem (NCBI)