CAS 1190319-82-4 is the registry number for METHYL 4-BROMO-7-AZAINDOLE-3-CARBOXYLATE, 96%. Offered by: Fluorochem. Available pack sizes: 5g.
Methyl 4-bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylate (CAS 1190319-82-4) is a chemical compound with the molecular formula C9H7BrN2O2 and a molecular weight of 255.07 g/mol. IUPAC name: methyl 4-bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylate. InChIKey: CPNMUJAOYRRWCQ-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O2 |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | methyl 4-bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylate |
| InChIKey | CPNMUJAOYRRWCQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CNC2=NC=CC(=C12)Br |
Computed by PubChem (NCBI)