CAS 1190320-08-1 appears in our catalog under these names: 6-Fluoroquinazolin-4-amine, 95%, 4-Amino-6-fluoroquinazoline. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 5g, 100mg, 50mg, 500mg, 1000mg.
6-fluoroquinazolin-4-amine (CAS 1190320-08-1) is a chemical compound with the molecular formula C8H6FN3 and a molecular weight of 163.15 g/mol. IUPAC name: 6-fluoroquinazolin-4-amine. InChIKey: ARIXAZJLBIBWSR-UHFFFAOYSA-N.
| Molecular formula | C8H6FN3 |
|---|---|
| Molecular weight | 163.15 g/mol |
| IUPAC name | 6-fluoroquinazolin-4-amine |
| InChIKey | ARIXAZJLBIBWSR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=NC=N2)N |
Computed by PubChem (NCBI)