Products 1505273-47-1
CAS 1505273-47-1 appears in our catalog under these names: 3-(2-Fluorophenyl)-4H-1,2,4-triazole, 98%, 3-(2-Fluorophenyl)-4H-1,2,4-triazole, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 100mg, 25g, 250mg.
5-(2-fluorophenyl)-1H-1,2,4-triazole (CAS 1505273-47-1) is a chemical compound with the molecular formula C8H6FN3 and a molecular weight of 163.15 g/mol. IUPAC name: 5-(2-fluorophenyl)-1H-1,2,4-triazole. InChIKey: KHBZSRUEXQMPOS-UHFFFAOYSA-N.
| Molecular formula | C8H6FN3 |
|---|---|
| Molecular weight | 163.15 g/mol |
| IUPAC name | 5-(2-fluorophenyl)-1H-1,2,4-triazole |
| InChIKey | KHBZSRUEXQMPOS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC=NN2)F |
Computed by PubChem (NCBI)