CAS 119054-38-5 is the registry number for α-Ethyl-α-methyl-1,3-benzodioxole-5-methanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-(1,3-benzodioxol-5-yl)butan-2-ol (CAS 119054-38-5) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: 2-(1,3-benzodioxol-5-yl)butan-2-ol. InChIKey: DKSCPXZPOFBPJP-UHFFFAOYSA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 2-(1,3-benzodioxol-5-yl)butan-2-ol |
| InChIKey | DKSCPXZPOFBPJP-UHFFFAOYSA-N |
| SMILES | CCC(C)(C1=CC2=C(C=C1)OCO2)O |
Computed by PubChem (NCBI)