CAS 1190968-76-3 is the registry number for 1-Chloro-2-(1-(p-tolyl)ethyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
1-chloro-2-[1-(4-methylphenyl)ethyl]benzene (CAS 1190968-76-3) is a chemical compound with the molecular formula C15H15Cl and a molecular weight of 230.73 g/mol. IUPAC name: 1-chloro-2-[1-(4-methylphenyl)ethyl]benzene. InChIKey: WEFLJEXPSLAWGV-UHFFFAOYSA-N.
| Molecular formula | C15H15Cl |
|---|---|
| Molecular weight | 230.73 g/mol |
| IUPAC name | 1-chloro-2-[1-(4-methylphenyl)ethyl]benzene |
| InChIKey | WEFLJEXPSLAWGV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(C)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)