CAS 53243-83-7 is the registry number for 4'-Chloro-2,4,6-trimethyl-1,1'-biphenyl, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(4-chlorophenyl)-1,3,5-trimethylbenzene (CAS 53243-83-7) is a chemical compound with the molecular formula C15H15Cl and a molecular weight of 230.73 g/mol. IUPAC name: 2-(4-chlorophenyl)-1,3,5-trimethylbenzene. InChIKey: OXSOLCFFZJJMOP-UHFFFAOYSA-N.
| Molecular formula | C15H15Cl |
|---|---|
| Molecular weight | 230.73 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-1,3,5-trimethylbenzene |
| InChIKey | OXSOLCFFZJJMOP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C2=CC=C(C=C2)Cl)C |
Computed by PubChem (NCBI)