Products 1191273-14-9
CAS 1191273-14-9 is the registry number for 1-(2,3-Dihydro-1H-inden-4-yl)guanidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,3-dihydro-1H-inden-4-yl)guanidine (CAS 1191273-14-9) is a chemical compound with the molecular formula C10H13N3 and a molecular weight of 175.23 g/mol. IUPAC name: 2-(2,3-dihydro-1H-inden-4-yl)guanidine. InChIKey: YZWCKPZTGKNZLS-UHFFFAOYSA-N.
| Molecular formula | C10H13N3 |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 2-(2,3-dihydro-1H-inden-4-yl)guanidine |
| InChIKey | YZWCKPZTGKNZLS-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C(=CC=C2)N=C(N)N |
Computed by PubChem (NCBI)