Products 119143-48-5
CAS 119143-48-5 appears in our catalog under these names: 1,4-Bisdesoxycyadox, ISO 17034 RM, 1,4-Bisdesoxycyadox, 100 µg/ml in Acetonitrile, ISO 17034 CRM. Offered by: HPC Standards. Available pack sizes: 10mg, 1ml.
2-cyano-N-[(E)-quinoxalin-2-ylmethylideneamino]acetamide (CAS 119143-48-5) is a chemical compound with the molecular formula C12H9N5O and a molecular weight of 239.23 g/mol. IUPAC name: 2-cyano-N-[(E)-quinoxalin-2-ylmethylideneamino]acetamide. InChIKey: HMAUMHGROVYCDY-OVCLIPMQSA-N.
| Molecular formula | C12H9N5O |
|---|---|
| Molecular weight | 239.23 g/mol |
| IUPAC name | 2-cyano-N-[(E)-quinoxalin-2-ylmethylideneamino]acetamide |
| InChIKey | HMAUMHGROVYCDY-OVCLIPMQSA-N |
| SMILES | C1=CC=C2C(=C1)N=CC(=N2)/C=N/NC(=O)CC#N |
Computed by PubChem (NCBI)