CAS 119145-87-8 appears in our catalog under these names: Cyclopropanecarboxylic acid, 1-[[(1,1-dimethylethoxy)carbonyl]methylamino]-, 95%, 95%, 1-((tert-Butoxycarbonyl)(methyl)amino)cyclopropane-1-carboxylic acid, 97%, Boc-N-Me-Acpc-OH, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
1-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]cyclopropane-1-carboxylic acid (CAS 119145-87-8) is a chemical compound with the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. IUPAC name: 1-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]cyclopropane-1-carboxylic acid. InChIKey: SGWWJFJPLPQMBP-UHFFFAOYSA-N.
| Molecular formula | C10H17NO4 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 1-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]cyclopropane-1-carboxylic acid |
| InChIKey | SGWWJFJPLPQMBP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)C1(CC1)C(=O)O |
Computed by PubChem (NCBI)