Products 119188-37-3
CAS 119188-37-3 appears in our catalog under these names: Coronarin D, Coronarin D, Coronarin D, ≥95%, ≥95%, Coronarin D, 97.0%. Offered by: Chemat Brand, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: on request, 1mg, 5mg, 10mg, 25mg, 1 mg, 5 mg.
(3Z)-3-[2-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethylidene]-5-hydroxyoxolan-2-one (CAS 119188-37-3) is a chemical compound with the molecular formula C20H30O3 and a molecular weight of 318.4 g/mol. IUPAC name: (3Z)-3-[2-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethylidene]-5-hydroxyoxolan-2-one. InChIKey: DYYYQLXAGIXUGM-FKKKBMQXSA-N.
| Molecular formula | C20H30O3 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | (3Z)-3-[2-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethylidene]-5-hydroxyoxolan-2-one |
| InChIKey | DYYYQLXAGIXUGM-FKKKBMQXSA-N |
| SMILES | C[C@]12CCCC([C@@H]1CCC(=C)[C@@H]2C/C=C\3/CC(OC3=O)O)(C)C |
Computed by PubChem (NCBI)
Synonyms:
Coronarin D