CAS 1192064-41-7 is the registry number for 3-(1H-1,2,4-Triazol-1-yl)phenol. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-(1,2,4-triazol-1-yl)phenol (CAS 1192064-41-7) is a chemical compound with the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. IUPAC name: 3-(1,2,4-triazol-1-yl)phenol. InChIKey: SHZZCMTYFATJGO-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 3-(1,2,4-triazol-1-yl)phenol |
| InChIKey | SHZZCMTYFATJGO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)N2C=NC=N2 |
Computed by PubChem (NCBI)