Products 1192176-44-5
CAS 1192176-44-5 is the registry number for (R)-Benzyl 2-((tert-butoxycarbonyl)amino)-4-(dimethylamino)-4-oxobutanoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
Benzyl (2R)-4-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate (CAS 1192176-44-5) is a chemical compound with the molecular formula C18H26N2O5 and a molecular weight of 350.4 g/mol. IUPAC name: benzyl (2R)-4-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate. InChIKey: AFYSGIXPJFRFHB-CQSZACIVSA-N.
| Molecular formula | C18H26N2O5 |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | benzyl (2R)-4-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate |
| InChIKey | AFYSGIXPJFRFHB-CQSZACIVSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)N(C)C)C(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)