CAS 930782-89-1 appears in our catalog under these names: (R)-4-Benzyl 1-tert-butyl 2-(hydroxymethyl)piperazine-1,4-dicarboxylate, 97%, (R)–4–Benzyl 1–tert–butyl 2–(hydroxymethyl)piperazine–1,4–dicarboxylate, (R)-4-Benzyl 1-tert-butyl 2-(hydroxymethyl)piperazine-1,4-dicarboxylate 97%, (R)-4-Benzyl 1-tert-butyl 2-(hydroxymethyl)piperazine-1,4-dicarboxylate, 97%, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 25g, 10g.
1-O-benzyl 4-O-tert-butyl (2R)-2-(hydroxymethyl)piperazine-1,4-dicarboxylate (CAS 930782-89-1) is a chemical compound with the molecular formula C18H26N2O5 and a molecular weight of 350.4 g/mol. IUPAC name: 1-O-benzyl 4-O-tert-butyl (2R)-2-(hydroxymethyl)piperazine-1,4-dicarboxylate. InChIKey: UINOMZOGOKYFHD-OAHLLOKOSA-N.
| Molecular formula | C18H26N2O5 |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | 1-O-benzyl 4-O-tert-butyl (2R)-2-(hydroxymethyl)piperazine-1,4-dicarboxylate |
| InChIKey | UINOMZOGOKYFHD-OAHLLOKOSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN([C@H](C1)CO)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)