Products 1192248-37-5
CAS 1192248-37-5 is the registry number for DHPCC-9. Offered by: MedChemExpress. Available pack sizes: Get quote.
1,10-dihydropyrrolo[2,3-a]carbazole-3-carbaldehyde (CAS 1192248-37-5) is a chemical compound with the molecular formula C15H10N2O and a molecular weight of 234.25 g/mol. IUPAC name: 1,10-dihydropyrrolo[2,3-a]carbazole-3-carbaldehyde. InChIKey: VWNCOFUKBTYAON-UHFFFAOYSA-N.
| Molecular formula | C15H10N2O |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | 1,10-dihydropyrrolo[2,3-a]carbazole-3-carbaldehyde |
| InChIKey | VWNCOFUKBTYAON-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C4=C(C=C3)C(=CN4)C=O |
Computed by PubChem (NCBI)