CAS 119264-63-0 is the registry number for Nonabromobiphenyl. Offered by: Chemat Brand. Available pack sizes: on request.
1,2,3,4,5-pentabromo-6-(2,3,5,6-tetrabromophenyl)benzene (CAS 119264-63-0) is a chemical compound with the molecular formula C12HBr9 and a molecular weight of 864.3 g/mol. IUPAC name: 1,2,3,4,5-pentabromo-6-(2,3,5,6-tetrabromophenyl)benzene. InChIKey: WOYQCNXYPKFHRQ-UHFFFAOYSA-N.
| Molecular formula | C12HBr9 |
|---|---|
| Molecular weight | 864.3 g/mol |
| IUPAC name | 1,2,3,4,5-pentabromo-6-(2,3,5,6-tetrabromophenyl)benzene |
| InChIKey | WOYQCNXYPKFHRQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)Br)C2=C(C(=C(C(=C2Br)Br)Br)Br)Br)Br)Br |
Computed by PubChem (NCBI)