CAS 69278-62-2 appears in our catalog under these names: 2,2',3,3',4,4,5,5',6-Nonabromobiphenyl, 2,2’,3,3’,4,4’,5,5’,6-Nonabromobiphenyl. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 1mg, 2mg, 5mg, 10mg.
1,2,3,4,5-pentabromo-6-(2,3,4,5-tetrabromophenyl)benzene (CAS 69278-62-2) is a chemical compound with the molecular formula C12HBr9 and a molecular weight of 864.3 g/mol. IUPAC name: 1,2,3,4,5-pentabromo-6-(2,3,4,5-tetrabromophenyl)benzene. InChIKey: QLERKXRXNDBTDM-UHFFFAOYSA-N.
| Molecular formula | C12HBr9 |
|---|---|
| Molecular weight | 864.3 g/mol |
| IUPAC name | 1,2,3,4,5-pentabromo-6-(2,3,4,5-tetrabromophenyl)benzene |
| InChIKey | QLERKXRXNDBTDM-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)Br)Br)Br)C2=C(C(=C(C(=C2Br)Br)Br)Br)Br |
Computed by PubChem (NCBI)