CAS 1193387-41-5 is the registry number for 1-{1H-pyrrolo(2,3-b)pyridine-3-sulfonyl}piperazine, 98%. Offered by: AmBeed. Available pack sizes: 5g.
3-piperazin-1-ylsulfonyl-1H-pyrrolo[2,3-b]pyridine (CAS 1193387-41-5) is a chemical compound with the molecular formula C11H14N4O2S and a molecular weight of 266.32 g/mol. IUPAC name: 3-piperazin-1-ylsulfonyl-1H-pyrrolo[2,3-b]pyridine. InChIKey: VTMBSTPGBSMDNH-UHFFFAOYSA-N.
| Molecular formula | C11H14N4O2S |
|---|---|
| Molecular weight | 266.32 g/mol |
| IUPAC name | 3-piperazin-1-ylsulfonyl-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | VTMBSTPGBSMDNH-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)S(=O)(=O)C2=CNC3=C2C=CC=N3 |
Computed by PubChem (NCBI)