Products 1193388-90-7

CAS 1193388-90-7 is the registry number for 3-Amino-n-(4-bromophenyl)propanamide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

3-amino-N-(4-bromophenyl)propanamide;hydrochloride (CAS 1193388-90-7) is a chemical compound with the molecular formula C9H12BrClN2O and a molecular weight of 279.56 g/mol. IUPAC name: 3-amino-N-(4-bromophenyl)propanamide;hydrochloride. InChIKey: XNTHPUDCCNQKNU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12BrClN2O
Molecular weight279.56 g/mol
IUPAC name3-amino-N-(4-bromophenyl)propanamide;hydrochloride
InChIKeyXNTHPUDCCNQKNU-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1NC(=O)CCN)Br.Cl

Computed by PubChem (NCBI)