CAS 1235440-42-2 is the registry number for 2-Amino-N-(4-bromo-3-methylphenyl)acetamide hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-amino-N-(4-bromo-3-methylphenyl)acetamide;hydrochloride (CAS 1235440-42-2) is a chemical compound with the molecular formula C9H12BrClN2O and a molecular weight of 279.56 g/mol. IUPAC name: 2-amino-N-(4-bromo-3-methylphenyl)acetamide;hydrochloride. InChIKey: LKIZJFZJFANOFY-UHFFFAOYSA-N.
| Molecular formula | C9H12BrClN2O |
|---|---|
| Molecular weight | 279.56 g/mol |
| IUPAC name | 2-amino-N-(4-bromo-3-methylphenyl)acetamide;hydrochloride |
| InChIKey | LKIZJFZJFANOFY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)NC(=O)CN)Br.Cl |
Computed by PubChem (NCBI)