CAS 1193389-97-7 is the registry number for 4-Amino-N-{4-(ethyl(2-hydroxyethyl)amino)phenyl}benzene-1-sulfonamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-amino-N-[4-[ethyl(2-hydroxyethyl)amino]phenyl]benzenesulfonamide (CAS 1193389-97-7) is a chemical compound with the molecular formula C16H21N3O3S and a molecular weight of 335.4 g/mol. IUPAC name: 4-amino-N-[4-[ethyl(2-hydroxyethyl)amino]phenyl]benzenesulfonamide. InChIKey: UTSSJPAPEISVPM-UHFFFAOYSA-N.
| Molecular formula | C16H21N3O3S |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 4-amino-N-[4-[ethyl(2-hydroxyethyl)amino]phenyl]benzenesulfonamide |
| InChIKey | UTSSJPAPEISVPM-UHFFFAOYSA-N |
| SMILES | CCN(CCO)C1=CC=C(C=C1)NS(=O)(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)