Products 21438-63-1
CAS 21438-63-1 appears in our catalog under these names: H–Trp–Met–OH, H-Trp-Met-OH. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1g, 250mg, 500mg, 1000mg, Get quote.
(2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylsulfanylbutanoic acid (CAS 21438-63-1) is a chemical compound with the molecular formula C16H21N3O3S and a molecular weight of 335.4 g/mol. IUPAC name: (2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylsulfanylbutanoic acid. InChIKey: BVZABQIRMYTKCF-JSGCOSHPSA-N.
| Molecular formula | C16H21N3O3S |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylsulfanylbutanoic acid |
| InChIKey | BVZABQIRMYTKCF-JSGCOSHPSA-N |
| SMILES | CSCC[C@@H](C(=O)O)NC(=O)[C@H](CC1=CNC2=CC=CC=C21)N |
Computed by PubChem (NCBI)