CAS 1193390-14-5 is the registry number for N-(4-(Chloromethyl)-1,3-thiazol-2-yl)-N-(4-fluorophenyl)acetamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
N-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(4-fluorophenyl)acetamide (CAS 1193390-14-5) is a chemical compound with the molecular formula C12H10ClFN2OS and a molecular weight of 284.74 g/mol. IUPAC name: N-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(4-fluorophenyl)acetamide. InChIKey: OVSLGBMBFQUOGJ-UHFFFAOYSA-N.
| Molecular formula | C12H10ClFN2OS |
|---|---|
| Molecular weight | 284.74 g/mol |
| IUPAC name | N-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(4-fluorophenyl)acetamide |
| InChIKey | OVSLGBMBFQUOGJ-UHFFFAOYSA-N |
| SMILES | CC(=O)N(C1=CC=C(C=C1)F)C2=NC(=CS2)CCl |
Computed by PubChem (NCBI)