CAS 450360-92-6 is the registry number for 2-Chloro-N-{5-((4-fluorophenyl)methyl)-1,3-thiazol-2-yl}acetamide. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-chloro-N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]acetamide (CAS 450360-92-6) is a chemical compound with the molecular formula C12H10ClFN2OS and a molecular weight of 284.74 g/mol. IUPAC name: 2-chloro-N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]acetamide. InChIKey: DQSXBGDQZPPDSC-UHFFFAOYSA-N.
| Molecular formula | C12H10ClFN2OS |
|---|---|
| Molecular weight | 284.74 g/mol |
| IUPAC name | 2-chloro-N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]acetamide |
| InChIKey | DQSXBGDQZPPDSC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=CN=C(S2)NC(=O)CCl)F |
Computed by PubChem (NCBI)