Products 1193390-17-8

CAS 1193390-17-8 appears in our catalog under these names: 2,6–Difluoro–N–methylaniline hydrochloride, 2,6-Difluoro-N-methylaniline Hydrochloride, 2,6-Difluoro-N-methylaniline hydrochloride 95%, 2,6-Difluoro-N-methylaniline hydrochloride, 98%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 2,5g.

Structural formula: {0} (CAS {1})

2,6-difluoro-N-methylaniline;hydrochloride (CAS 1193390-17-8) is a chemical compound with the molecular formula C7H8ClF2N and a molecular weight of 179.59 g/mol. IUPAC name: 2,6-difluoro-N-methylaniline;hydrochloride. InChIKey: ZZFOBJPJVHXBFA-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8ClF2N
Molecular weight179.59 g/mol
IUPAC name2,6-difluoro-N-methylaniline;hydrochloride
InChIKeyZZFOBJPJVHXBFA-UHFFFAOYSA-N
SMILESCNC1=C(C=CC=C1F)F.Cl

Computed by PubChem (NCBI)