Products 2376634-09-0

CAS 2376634-09-0 appears in our catalog under these names: 2,6-Difluoro-4-methylaniline hydrochloride, 95%, 2,6-Difluoro-4-methylaniline hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2,6-difluoro-4-methylaniline;hydrochloride (CAS 2376634-09-0) is a chemical compound with the molecular formula C7H8ClF2N and a molecular weight of 179.59 g/mol. IUPAC name: 2,6-difluoro-4-methylaniline;hydrochloride. InChIKey: JADVGBAJLYLHSN-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8ClF2N
Molecular weight179.59 g/mol
IUPAC name2,6-difluoro-4-methylaniline;hydrochloride
InChIKeyJADVGBAJLYLHSN-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=C1)F)N)F.Cl

Computed by PubChem (NCBI)